Carboxylic acids and derivatives
Filtered Search Results
Dimethyl Fumarate, Certified Reference Material, MilliporeSigma™ Supelco™
Pharmaceutical secondary standards for application in quality control. Provides pharma laboratories and manufacturers with a convenient, and cost-effective alternative to the preparation of in-house working standards.
Lithium isobutyrate, 98+%
CAS: 25179-23-1 Molecular Formula: C4H7LiO2 Molecular Weight (g/mol): 94.038 MDL Number: MFCD00210622 InChI Key: IIDVGIFOWJJSIJ-UHFFFAOYSA-M Synonym: lithium isobutyrate,lithium 2-methylpropanoate,acmc-1ccd2,isobutyric acid lithium salt,lithium 1+ isobutyrate,lithium 1+ ion isobutyrate PubChem CID: 23665557 IUPAC Name: lithium;2-methylpropanoate SMILES: [Li+].CC(C)C(=O)[O-]
| PubChem CID | 23665557 |
|---|---|
| CAS | 25179-23-1 |
| Molecular Weight (g/mol) | 94.038 |
| MDL Number | MFCD00210622 |
| SMILES | [Li+].CC(C)C(=O)[O-] |
| Synonym | lithium isobutyrate,lithium 2-methylpropanoate,acmc-1ccd2,isobutyric acid lithium salt,lithium 1+ isobutyrate,lithium 1+ ion isobutyrate |
| IUPAC Name | lithium;2-methylpropanoate |
| InChI Key | IIDVGIFOWJJSIJ-UHFFFAOYSA-M |
| Molecular Formula | C4H7LiO2 |
| CAS | 6089-09-4 |
|---|---|
| MDL Number | MFCD00004407 |
Rubidium formate hydrate, 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 3495-35-0 Molecular Formula: CHO2Rb Molecular Weight (g/mol): 130.49 MDL Number: MFCD00054359 InChI Key: ZIMBPNXOLRMVGV-UHFFFAOYSA-M Synonym: rubidium formate,formic acid, rubidium salt,formic acid rubidium salt,64-18-6 parent,formic acid, rubidium salt 1:1,rubidiumformiat,rubidium 1+ formira,rubidium 1+ formate,rubidium 1+ ion formate,formic acid, rubidiumsalt 1:1 PubChem CID: 23673641 IUPAC Name: rubidium(1+) formate SMILES: [Rb+].[O-]C=O
| PubChem CID | 23673641 |
|---|---|
| CAS | 3495-35-0 |
| Molecular Weight (g/mol) | 130.49 |
| MDL Number | MFCD00054359 |
| SMILES | [Rb+].[O-]C=O |
| Synonym | rubidium formate,formic acid, rubidium salt,formic acid rubidium salt,64-18-6 parent,formic acid, rubidium salt 1:1,rubidiumformiat,rubidium 1+ formira,rubidium 1+ formate,rubidium 1+ ion formate,formic acid, rubidiumsalt 1:1 |
| IUPAC Name | rubidium(1+) formate |
| InChI Key | ZIMBPNXOLRMVGV-UHFFFAOYSA-M |
| Molecular Formula | CHO2Rb |
Propionic acid, sodium salt, 99.0-100.5%
CAS: 137-40-6 Molecular Formula: C3H5NaO2 Molecular Weight (g/mol): 96.06 MDL Number: MFCD00002759 InChI Key: JXKPEJDQGNYQSM-UHFFFAOYSA-M Synonym: sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar PubChem CID: 2723816 IUPAC Name: sodium;propanoate SMILES: CCC(=O)[O-].[Na+]
| PubChem CID | 2723816 |
|---|---|
| CAS | 137-40-6 |
| Molecular Weight (g/mol) | 96.06 |
| MDL Number | MFCD00002759 |
| SMILES | CCC(=O)[O-].[Na+] |
| Synonym | sodium propionate,sodium propanoate,propionic acid sodium salt,propanoic acid, sodium salt,napropion,ocuseptine,deketon,impedex,keenate,propiofar |
| IUPAC Name | sodium;propanoate |
| InChI Key | JXKPEJDQGNYQSM-UHFFFAOYSA-M |
| Molecular Formula | C3H5NaO2 |
Dimethyl acetylenedicarboxylate, 95%
CAS: 762-42-5 Molecular Formula: C6H6O4 Molecular Weight (g/mol): 142.11 MDL Number: MFCD00008456 InChI Key: VHILMKFSCRWWIJ-UHFFFAOYSA-N Synonym: dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene PubChem CID: 12980 IUPAC Name: dimethyl but-2-ynedioate SMILES: COC(=O)C#CC(=O)OC
| PubChem CID | 12980 |
|---|---|
| CAS | 762-42-5 |
| Molecular Weight (g/mol) | 142.11 |
| MDL Number | MFCD00008456 |
| SMILES | COC(=O)C#CC(=O)OC |
| Synonym | dimethyl acetylenedicarboxylate,2-butynedioic acid, dimethyl ester,1,4-dimethyl but-2-ynedioate,dimethyl butynedioate,dimethyl 2-butynedioate,acetylenedicarboxylic acid dimethyl ester,dmad,methyl acetylenedicarboxylate,bis methoxycarbonyl acetylene,di carbomethoxy acetylene |
| IUPAC Name | dimethyl but-2-ynedioate |
| InChI Key | VHILMKFSCRWWIJ-UHFFFAOYSA-N |
| Molecular Formula | C6H6O4 |
Manganese(II) oxalate dihydrate, Mn 30% min
CAS: 6556-16-7 Molecular Formula: C2H4MnO6 Molecular Weight (g/mol): 178.986 MDL Number: MFCD00150452 InChI Key: HDJUVFZHZGPHCQ-UHFFFAOYSA-L Synonym: manganese ii oxalate 2-hydrate PubChem CID: 131882857 IUPAC Name: manganese(2+);oxalate;dihydrate SMILES: C(=O)(C(=O)[O-])[O-].O.O.[Mn+2]
| PubChem CID | 131882857 |
|---|---|
| CAS | 6556-16-7 |
| Molecular Weight (g/mol) | 178.986 |
| MDL Number | MFCD00150452 |
| SMILES | C(=O)(C(=O)[O-])[O-].O.O.[Mn+2] |
| Synonym | manganese ii oxalate 2-hydrate |
| IUPAC Name | manganese(2+);oxalate;dihydrate |
| InChI Key | HDJUVFZHZGPHCQ-UHFFFAOYSA-L |
| Molecular Formula | C2H4MnO6 |
Methyl isobutyrate, 98%
CAS: 547-63-7 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.133 MDL Number: MFCD00008914 InChI Key: BHIWKHZACMWKOJ-UHFFFAOYSA-N Synonym: methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne PubChem CID: 11039 ChEBI: CHEBI:73689 IUPAC Name: methyl 2-methylpropanoate SMILES: CC(C)C(=O)OC
| PubChem CID | 11039 |
|---|---|
| CAS | 547-63-7 |
| Molecular Weight (g/mol) | 102.133 |
| ChEBI | CHEBI:73689 |
| MDL Number | MFCD00008914 |
| SMILES | CC(C)C(=O)OC |
| Synonym | methyl isobutyrate,methyl 2-methylpropionate,methyl isobutanoate,propanoic acid, 2-methyl-, methyl ester,isobutyric acid, methyl ester,methylisobutyrate,isobutyric acid methyl ester,poly d-lactide,methyl isobutyrate natural,methylester kyseliny isomaselne |
| IUPAC Name | methyl 2-methylpropanoate |
| InChI Key | BHIWKHZACMWKOJ-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
Methyl 3-(methylthio)propionate, 98%
CAS: 13532-18-8 Molecular Formula: C5H10O2S Molecular Weight (g/mol): 134.19 MDL Number: MFCD00008565 InChI Key: DMMJVMYCBULSIS-UHFFFAOYSA-N Synonym: methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate PubChem CID: 61641 IUPAC Name: methyl 3-methylsulfanylpropanoate SMILES: COC(=O)CCSC
| PubChem CID | 61641 |
|---|---|
| CAS | 13532-18-8 |
| Molecular Weight (g/mol) | 134.19 |
| MDL Number | MFCD00008565 |
| SMILES | COC(=O)CCSC |
| Synonym | methyl 3-methylthio propionate,methyl 3-methylthiopropionate,methyl 3-methylthio propanoate,propanoic acid, 3-methylthio-, methyl ester,methyl beta-methiopropionate,methyl 3-methylsulfanyl propanoate,methyl-3-methylthio propionate,methyl 3-methylthiopropanoate,propionic acid, 3-methylthio-, methyl ester,methyl beta-methylthiopropionate |
| IUPAC Name | methyl 3-methylsulfanylpropanoate |
| InChI Key | DMMJVMYCBULSIS-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2S |
Methyl dimethoxyacetate, 96%
CAS: 89-91-8 Molecular Formula: C5H10O4 Molecular Weight (g/mol): 134.131 MDL Number: MFCD00008484 InChI Key: NZTCVGHPDWAALP-UHFFFAOYSA-N Synonym: methyl dimethoxyacetate,acetic acid, dimethoxy-, methyl ester,dimethoxyacetic acid methyl ester,glyoxylic acid methyl ester dimethyl acetal,acetic acid, 2,2-dimethoxy-, methyl ester,glyoxylic acid, methyl ester, 2-dimethyl acetal,zlchem 519,acmc-209r3k,ksc490c4f,methyl 2,2-dimethoxyethanoate PubChem CID: 66647 IUPAC Name: methyl 2,2-dimethoxyacetate SMILES: COC(C(=O)OC)OC
| PubChem CID | 66647 |
|---|---|
| CAS | 89-91-8 |
| Molecular Weight (g/mol) | 134.131 |
| MDL Number | MFCD00008484 |
| SMILES | COC(C(=O)OC)OC |
| Synonym | methyl dimethoxyacetate,acetic acid, dimethoxy-, methyl ester,dimethoxyacetic acid methyl ester,glyoxylic acid methyl ester dimethyl acetal,acetic acid, 2,2-dimethoxy-, methyl ester,glyoxylic acid, methyl ester, 2-dimethyl acetal,zlchem 519,acmc-209r3k,ksc490c4f,methyl 2,2-dimethoxyethanoate |
| IUPAC Name | methyl 2,2-dimethoxyacetate |
| InChI Key | NZTCVGHPDWAALP-UHFFFAOYSA-N |
| Molecular Formula | C5H10O4 |
3-Nitrophthalimide, 98%
CAS: 603-62-3 Molecular Formula: C8H4N2O4 Molecular Weight (g/mol): 192.13 MDL Number: MFCD00041852 InChI Key: BONIIQYTWOPUQI-UHFFFAOYSA-N Synonym: 3-nitrophthalimide,4-nitroisoindoline-1,3-dione,phthalimide, 3-nitro,1h-isoindole-1,3 2h-dione, 4-nitro,nitrophthalimide,4-nitro-2,3-dihydro-1h-isoindole-1,3-dione,4-nitro-1h-isoindole-1,3 2h-dione,4-nitro-2h-benzo c azoline-1,3-dione,3-nitro-phthalimide,pubchem12007 PubChem CID: 11779 IUPAC Name: 4-nitroisoindole-1,3-dione SMILES: C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC2=O
| PubChem CID | 11779 |
|---|---|
| CAS | 603-62-3 |
| Molecular Weight (g/mol) | 192.13 |
| MDL Number | MFCD00041852 |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC2=O |
| Synonym | 3-nitrophthalimide,4-nitroisoindoline-1,3-dione,phthalimide, 3-nitro,1h-isoindole-1,3 2h-dione, 4-nitro,nitrophthalimide,4-nitro-2,3-dihydro-1h-isoindole-1,3-dione,4-nitro-1h-isoindole-1,3 2h-dione,4-nitro-2h-benzo c azoline-1,3-dione,3-nitro-phthalimide,pubchem12007 |
| IUPAC Name | 4-nitroisoindole-1,3-dione |
| InChI Key | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| Molecular Formula | C8H4N2O4 |
Dimethyl phthalate, 99%
CAS: 131-11-3 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00008425 InChI Key: NIQCNGHVCWTJSM-UHFFFAOYSA-N Synonym: dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm PubChem CID: 8554 ChEBI: CHEBI:4609 SMILES: COC(=O)C1=CC=CC=C1C(=O)OC
| PubChem CID | 8554 |
|---|---|
| CAS | 131-11-3 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:4609 |
| MDL Number | MFCD00008425 |
| SMILES | COC(=O)C1=CC=CC=C1C(=O)OC |
| Synonym | dimethyl phthalate,dimethylphthalate,solvanom,solvarone,avolin,fermine,phthalic acid dimethyl ester,mipax,palatinol m,unimoll dm |
| InChI Key | NIQCNGHVCWTJSM-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Ethyl 4,4,4-trifluoro-2-butynoate, 97%
CAS: 79424-03-6 Molecular Formula: C6H5F3O2 Molecular Weight (g/mol): 166.099 MDL Number: MFCD00192167 InChI Key: SFDRHPQGYUYYNX-UHFFFAOYSA-N Synonym: ethyl 4,4,4-trifluoro-2-butynoate,4,4,4-trifluoro-2-butynoic acid ethyl ester,4,4,4-trifluoro-but-2-ynoic acid ethyl ester,pubchem10880,acmc-1bc5r,ethyl4,4,4-trifluoro-2-butynoate,ethyl 4,4,4-trifluoro-2-butynate,trifluoro-2-butynoic acid ethyl ester,ethyl 4,4,4-trifluorobutynoate,ethyl 4,4,4-tris fluoranyl but-2-ynoate PubChem CID: 3597254 IUPAC Name: ethyl 4,4,4-trifluorobut-2-ynoate SMILES: CCOC(=O)C#CC(F)(F)F
| PubChem CID | 3597254 |
|---|---|
| CAS | 79424-03-6 |
| Molecular Weight (g/mol) | 166.099 |
| MDL Number | MFCD00192167 |
| SMILES | CCOC(=O)C#CC(F)(F)F |
| Synonym | ethyl 4,4,4-trifluoro-2-butynoate,4,4,4-trifluoro-2-butynoic acid ethyl ester,4,4,4-trifluoro-but-2-ynoic acid ethyl ester,pubchem10880,acmc-1bc5r,ethyl4,4,4-trifluoro-2-butynoate,ethyl 4,4,4-trifluoro-2-butynate,trifluoro-2-butynoic acid ethyl ester,ethyl 4,4,4-trifluorobutynoate,ethyl 4,4,4-tris fluoranyl but-2-ynoate |
| IUPAC Name | ethyl 4,4,4-trifluorobut-2-ynoate |
| InChI Key | SFDRHPQGYUYYNX-UHFFFAOYSA-N |
| Molecular Formula | C6H5F3O2 |
Methyl 1-cyclopentene-1-carboxylate, 95%
CAS: 25662-28-6 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD00239506 InChI Key: VTYCAXIAUKEGBQ-UHFFFAOYSA-N Synonym: methyl 1-cyclopentene-1-carboxylate,methyl cyclopent-1-enecarboxylate,methyl cyclopent-1-ene-1-carboxylate,cyclopentene-1-carboxylic acid methyl ester,methyl 1-cyclopentenecarboxylate,1-cyclopentenecarboxylic acid methyl ester,1-cyclopentene-1-carboxylic acid, methyl ester,methyl1-cyclopentene-1-carboxylate,1-cyclopentene-1-carboxylic acid methyl ester,pubchem2487 PubChem CID: 549129 IUPAC Name: methyl cyclopentene-1-carboxylate SMILES: COC(=O)C1=CCCC1
| PubChem CID | 549129 |
|---|---|
| CAS | 25662-28-6 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD00239506 |
| SMILES | COC(=O)C1=CCCC1 |
| Synonym | methyl 1-cyclopentene-1-carboxylate,methyl cyclopent-1-enecarboxylate,methyl cyclopent-1-ene-1-carboxylate,cyclopentene-1-carboxylic acid methyl ester,methyl 1-cyclopentenecarboxylate,1-cyclopentenecarboxylic acid methyl ester,1-cyclopentene-1-carboxylic acid, methyl ester,methyl1-cyclopentene-1-carboxylate,1-cyclopentene-1-carboxylic acid methyl ester,pubchem2487 |
| IUPAC Name | methyl cyclopentene-1-carboxylate |
| InChI Key | VTYCAXIAUKEGBQ-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
Sodium Benzoate, Powder, FCC, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 532-32-1 Molecular Formula: C7H5NaO2 Molecular Weight (g/mol): 144.11 MDL Number: MFCD00012463 InChI Key: WXMKPNITSTVMEF-UHFFFAOYSA-M IUPAC Name: sodium benzoate SMILES: [Na+].[O-]C(=O)C1=CC=CC=C1
| CAS | 532-32-1 |
|---|---|
| Molecular Weight (g/mol) | 144.11 |
| MDL Number | MFCD00012463 |
| SMILES | [Na+].[O-]C(=O)C1=CC=CC=C1 |
| IUPAC Name | sodium benzoate |
| InChI Key | WXMKPNITSTVMEF-UHFFFAOYSA-M |
| Molecular Formula | C7H5NaO2 |